C9H13N3S2 — CID 103420862
3-amino-5-[ethyl(methyl)amino]-4-methylsulfanylthiophene-2-carbonitrile (PubChem CID 103420862) has the molecular formula C9H13N3S2 and a molecular weight of 227.36 g/mol. Its IUPAC name is 3-amino-5-[ethyl(methyl)amino]-4-methylsulfanylthiophene-2-carbonitrile.
| Compound Name | 3-amino-5-[ethyl(methyl)amino]-4-methylsulfanylthiophene-2-carbonitrile |
|---|---|
| PubChem CID | 103420862 |
| Molecular Formula | C9H13N3S2 |
| Molecular Weight | 227.36 g/mol |
| Exact Mass | 227.06 |
| IUPAC Name | 3-amino-5-[ethyl(methyl)amino]-4-methylsulfanylthiophene-2-carbonitrile |
| SMILES | CCN(C)c1sc(C#N)c(N)c1SC |
| InChI | InChI=1S/C9H13N3S2/c1-4-12(2)9-8(13-3)7(11)6(5-10)14-9/h4,11H2,1-3H3 |
| InChIKey | MGBUFKNJCOQCOG-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 53.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.36 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |