C14H21N3O2S2 — CID 103417947
3-amino-5-[cyclohexylmethyl(methyl)amino]-4-methylsulfonylthiophene-2-carbonitrile (PubChem CID 103417947) has the molecular formula C14H21N3O2S2 and a molecular weight of 327.48 g/mol. Its IUPAC name is 3-amino-5-[cyclohexylmethyl(methyl)amino]-4-methylsulfonylthiophene-2-carbonitrile.
| Compound Name | 3-amino-5-[cyclohexylmethyl(methyl)amino]-4-methylsulfonylthiophene-2-carbonitrile |
|---|---|
| PubChem CID | 103417947 |
| Molecular Formula | C14H21N3O2S2 |
| Molecular Weight | 327.48 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | 3-amino-5-[cyclohexylmethyl(methyl)amino]-4-methylsulfonylthiophene-2-carbonitrile |
| SMILES | CN(CC1CCCCC1)c1sc(C#N)c(N)c1S(C)(=O)=O |
| InChI | InChI=1S/C14H21N3O2S2/c1-17(9-10-6-4-3-5-7-10)14-13(21(2,18)19)12(16)11(8-15)20-14/h10H,3-7,9,16H2,1-2H3 |
| InChIKey | ARPFRWJEPQMQAZ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 87.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.48 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |