C14H19N3O2S — CID 103421475
ethyl 4-amino-5-cyano-2-[cyclobutylmethyl(methyl)amino]thiophene-3-carboxylate (PubChem CID 103421475) has the molecular formula C14H19N3O2S and a molecular weight of 293.39 g/mol. Its IUPAC name is ethyl 4-amino-5-cyano-2-[cyclobutylmethyl(methyl)amino]thiophene-3-carboxylate.
| Compound Name | ethyl 4-amino-5-cyano-2-[cyclobutylmethyl(methyl)amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 103421475 |
| Molecular Formula | C14H19N3O2S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | ethyl 4-amino-5-cyano-2-[cyclobutylmethyl(methyl)amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(N(C)CC2CCC2)sc(C#N)c1N |
| InChI | InChI=1S/C14H19N3O2S/c1-3-19-14(18)11-12(16)10(7-15)20-13(11)17(2)8-9-5-4-6-9/h9H,3-6,8,16H2,1-2H3 |
| InChIKey | YARBEORSOFWSRW-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 79.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |