C13H19N3O2S — CID 103417875
methyl 4-amino-5-cyano-2-[methyl(3-methylbutyl)amino]thiophene-3-carboxylate (PubChem CID 103417875) has the molecular formula C13H19N3O2S and a molecular weight of 281.38 g/mol. Its IUPAC name is methyl 4-amino-5-cyano-2-[methyl(3-methylbutyl)amino]thiophene-3-carboxylate.
| Compound Name | methyl 4-amino-5-cyano-2-[methyl(3-methylbutyl)amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 103417875 |
| Molecular Formula | C13H19N3O2S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | methyl 4-amino-5-cyano-2-[methyl(3-methylbutyl)amino]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(N(C)CCC(C)C)sc(C#N)c1N |
| InChI | InChI=1S/C13H19N3O2S/c1-8(2)5-6-16(3)12-10(13(17)18-4)11(15)9(7-14)19-12/h8H,5-6,15H2,1-4H3 |
| InChIKey | UQZFFOOISKICBN-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 79.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |