C11H16N4O2S — CID 103424377
methyl 4-amino-5-cyano-2-[2-(dimethylamino)ethylamino]thiophene-3-carboxylate (PubChem CID 103424377) has the molecular formula C11H16N4O2S and a molecular weight of 268.34 g/mol. Its IUPAC name is methyl 4-amino-5-cyano-2-[2-(dimethylamino)ethylamino]thiophene-3-carboxylate.
| Compound Name | methyl 4-amino-5-cyano-2-[2-(dimethylamino)ethylamino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 103424377 |
| Molecular Formula | C11H16N4O2S |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | methyl 4-amino-5-cyano-2-[2-(dimethylamino)ethylamino]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NCCN(C)C)sc(C#N)c1N |
| InChI | InChI=1S/C11H16N4O2S/c1-15(2)5-4-14-10-8(11(16)17-3)9(13)7(6-12)18-10/h14H,4-5,13H2,1-3H3 |
| InChIKey | RRGMDWLUGTVCFU-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 91.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |