C10H13N3O4S2 — CID 103432229
methyl 4-amino-5-cyano-2-(2-methylsulfonylethylamino)thiophene-3-carboxylate (PubChem CID 103432229) has the molecular formula C10H13N3O4S2 and a molecular weight of 303.37 g/mol. Its IUPAC name is methyl 4-amino-5-cyano-2-(2-methylsulfonylethylamino)thiophene-3-carboxylate.
| Compound Name | methyl 4-amino-5-cyano-2-(2-methylsulfonylethylamino)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 103432229 |
| Molecular Formula | C10H13N3O4S2 |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | methyl 4-amino-5-cyano-2-(2-methylsulfonylethylamino)thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NCCS(C)(=O)=O)sc(C#N)c1N |
| InChI | InChI=1S/C10H13N3O4S2/c1-17-10(14)7-8(12)6(5-11)18-9(7)13-3-4-19(2,15)16/h13H,3-4,12H2,1-2H3 |
| InChIKey | SAFZHORLGFKTGB-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 122.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |