C8H11N3O2S2 — CID 103432311
3-amino-5-(2-methylsulfonylethylamino)thiophene-2-carbonitrile (PubChem CID 103432311) has the molecular formula C8H11N3O2S2 and a molecular weight of 245.33 g/mol. Its IUPAC name is 3-amino-5-(2-methylsulfonylethylamino)thiophene-2-carbonitrile.
| Compound Name | 3-amino-5-(2-methylsulfonylethylamino)thiophene-2-carbonitrile |
|---|---|
| PubChem CID | 103432311 |
| Molecular Formula | C8H11N3O2S2 |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.03 |
| IUPAC Name | 3-amino-5-(2-methylsulfonylethylamino)thiophene-2-carbonitrile |
| SMILES | CS(=O)(=O)CCNc1cc(N)c(C#N)s1 |
| InChI | InChI=1S/C8H11N3O2S2/c1-15(12,13)3-2-11-8-4-6(10)7(5-9)14-8/h4,11H,2-3,10H2,1H3 |
| InChIKey | FHITVNPSOANDIM-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |