C9H11N3S — CID 103424676
3-amino-5-(cyclopropylmethylamino)thiophene-2-carbonitrile (PubChem CID 103424676) has the molecular formula C9H11N3S and a molecular weight of 193.27 g/mol. Its IUPAC name is 3-amino-5-(cyclopropylmethylamino)thiophene-2-carbonitrile.
| Compound Name | 3-amino-5-(cyclopropylmethylamino)thiophene-2-carbonitrile |
|---|---|
| PubChem CID | 103424676 |
| Molecular Formula | C9H11N3S |
| Molecular Weight | 193.27 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 3-amino-5-(cyclopropylmethylamino)thiophene-2-carbonitrile |
| SMILES | N#Cc1sc(NCC2CC2)cc1N |
| InChI | InChI=1S/C9H11N3S/c10-4-8-7(11)3-9(13-8)12-5-6-1-2-6/h3,6,12H,1-2,5,11H2 |
| InChIKey | RMAGLDRKDQATBL-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.27 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |