C13H21N5OS — CID 106044889
4-amino-5-cyano-2-[3-[methyl(propan-2-yl)amino]propylamino]thiophene-3-carboxamide (PubChem CID 106044889) has the molecular formula C13H21N5OS and a molecular weight of 295.41 g/mol. Its IUPAC name is 4-amino-5-cyano-2-[3-[methyl(propan-2-yl)amino]propylamino]thiophene-3-carboxamide.
| Compound Name | 4-amino-5-cyano-2-[3-[methyl(propan-2-yl)amino]propylamino]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 106044889 |
| Molecular Formula | C13H21N5OS |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | 4-amino-5-cyano-2-[3-[methyl(propan-2-yl)amino]propylamino]thiophene-3-carboxamide |
| SMILES | CC(C)N(C)CCCNc1sc(C#N)c(N)c1C(N)=O |
| InChI | InChI=1S/C13H21N5OS/c1-8(2)18(3)6-4-5-17-13-10(12(16)19)11(15)9(7-14)20-13/h8,17H,4-6,15H2,1-3H3,(H2,16,19) |
| InChIKey | QGKRZACTPRHTBW-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 108.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|