C13H19N5S — CID 106044905
3-amino-5-[3-[methyl(propan-2-yl)amino]propylamino]thiophene-2,4-dicarbonitrile (PubChem CID 106044905) has the molecular formula C13H19N5S and a molecular weight of 277.40 g/mol. Its IUPAC name is 3-amino-5-[3-[methyl(propan-2-yl)amino]propylamino]thiophene-2,4-dicarbonitrile.
| Compound Name | 3-amino-5-[3-[methyl(propan-2-yl)amino]propylamino]thiophene-2,4-dicarbonitrile |
|---|---|
| PubChem CID | 106044905 |
| Molecular Formula | C13H19N5S |
| Molecular Weight | 277.40 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | 3-amino-5-[3-[methyl(propan-2-yl)amino]propylamino]thiophene-2,4-dicarbonitrile |
| SMILES | CC(C)N(C)CCCNc1sc(C#N)c(N)c1C#N |
| InChI | InChI=1S/C13H19N5S/c1-9(2)18(3)6-4-5-17-13-10(7-14)12(16)11(8-15)19-13/h9,17H,4-6,16H2,1-3H3 |
| InChIKey | ZLPKEOIFHFPWQZ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 88.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.40 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|