C15H21N5S — CID 103425718
3-amino-5-[3-(2-methylpiperidin-1-yl)propylamino]thiophene-2,4-dicarbonitrile (PubChem CID 103425718) has the molecular formula C15H21N5S and a molecular weight of 303.44 g/mol. Its IUPAC name is 3-amino-5-[3-(2-methylpiperidin-1-yl)propylamino]thiophene-2,4-dicarbonitrile.
| Compound Name | 3-amino-5-[3-(2-methylpiperidin-1-yl)propylamino]thiophene-2,4-dicarbonitrile |
|---|---|
| PubChem CID | 103425718 |
| Molecular Formula | C15H21N5S |
| Molecular Weight | 303.44 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | 3-amino-5-[3-(2-methylpiperidin-1-yl)propylamino]thiophene-2,4-dicarbonitrile |
| SMILES | CC1CCCCN1CCCNc1sc(C#N)c(N)c1C#N |
| InChI | InChI=1S/C15H21N5S/c1-11-5-2-3-7-20(11)8-4-6-19-15-12(9-16)14(18)13(10-17)21-15/h11,19H,2-8,18H2,1H3 |
| InChIKey | GRIXGNAPBVBBKQ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 88.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.44 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|