C16H22BrN3 — CID 82797715
3-bromo-4-[3-(2-methylpiperidin-1-yl)propylamino]benzonitrile (PubChem CID 82797715) has the molecular formula C16H22BrN3 and a molecular weight of 336.28 g/mol. Its IUPAC name is 3-bromo-4-[3-(2-methylpiperidin-1-yl)propylamino]benzonitrile.
| Compound Name | 3-bromo-4-[3-(2-methylpiperidin-1-yl)propylamino]benzonitrile |
|---|---|
| PubChem CID | 82797715 |
| Molecular Formula | C16H22BrN3 |
| Molecular Weight | 336.28 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | 3-bromo-4-[3-(2-methylpiperidin-1-yl)propylamino]benzonitrile |
| SMILES | CC1CCCCN1CCCNc1ccc(C#N)cc1Br |
| InChI | InChI=1S/C16H22BrN3/c1-13-5-2-3-9-20(13)10-4-8-19-16-7-6-14(12-18)11-15(16)17/h6-7,11,13,19H,2-5,8-10H2,1H3 |
| InChIKey | XBDHTONBISZNDO-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.28 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|