C11H20N4S — CID 65271137
N-[3-(2-methylpiperidin-1-yl)propyl]-1,2,4-thiadiazol-5-amine (PubChem CID 65271137) has the molecular formula C11H20N4S and a molecular weight of 240.38 g/mol. Its IUPAC name is N-[3-(2-methylpiperidin-1-yl)propyl]-1,2,4-thiadiazol-5-amine.
| Compound Name | N-[3-(2-methylpiperidin-1-yl)propyl]-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 65271137 |
| Molecular Formula | C11H20N4S |
| Molecular Weight | 240.38 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | N-[3-(2-methylpiperidin-1-yl)propyl]-1,2,4-thiadiazol-5-amine |
| SMILES | CC1CCCCN1CCCNc1ncns1 |
| InChI | InChI=1S/C11H20N4S/c1-10-5-2-3-7-15(10)8-4-6-12-11-13-9-14-16-11/h9-10H,2-8H2,1H3,(H,12,13,14) |
| InChIKey | CPEIPPXLXKKTTF-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.38 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|