C13H22N4 — CID 62483663
N-[3-(2-methylpiperidin-1-yl)propyl]pyridazin-3-amine (PubChem CID 62483663) has the molecular formula C13H22N4 and a molecular weight of 234.35 g/mol. Its IUPAC name is N-[3-(2-methylpiperidin-1-yl)propyl]pyridazin-3-amine.
| Compound Name | N-[3-(2-methylpiperidin-1-yl)propyl]pyridazin-3-amine |
|---|---|
| PubChem CID | 62483663 |
| Molecular Formula | C13H22N4 |
| Molecular Weight | 234.35 g/mol |
| Exact Mass | 234.18 |
| IUPAC Name | N-[3-(2-methylpiperidin-1-yl)propyl]pyridazin-3-amine |
| SMILES | CC1CCCCN1CCCNc1cccnn1 |
| InChI | InChI=1S/C13H22N4/c1-12-6-2-3-10-17(12)11-5-8-14-13-7-4-9-15-16-13/h4,7,9,12H,2-3,5-6,8,10-11H2,1H3,(H,14,16) |
| InChIKey | RLAHGPXDMATFDJ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.35 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|