C14H25N5 — CID 114448150
5,6-dimethyl-N-[3-(2-methylpiperidin-1-yl)propyl]-1,2,4-triazin-3-amine (PubChem CID 114448150) has the molecular formula C14H25N5 and a molecular weight of 263.39 g/mol. Its IUPAC name is 5,6-dimethyl-N-[3-(2-methylpiperidin-1-yl)propyl]-1,2,4-triazin-3-amine.
| Compound Name | 5,6-dimethyl-N-[3-(2-methylpiperidin-1-yl)propyl]-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 114448150 |
| Molecular Formula | C14H25N5 |
| Molecular Weight | 263.39 g/mol |
| Exact Mass | 263.21 |
| IUPAC Name | 5,6-dimethyl-N-[3-(2-methylpiperidin-1-yl)propyl]-1,2,4-triazin-3-amine |
| SMILES | Cc1nnc(NCCCN2CCCCC2C)nc1C |
| InChI | InChI=1S/C14H25N5/c1-11-7-4-5-9-19(11)10-6-8-15-14-16-12(2)13(3)17-18-14/h11H,4-10H2,1-3H3,(H,15,16,18) |
| InChIKey | INWOEPSSLAOIQQ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.39 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|