C18H33N5 — CID 154463494
4-N-(3-methylbutyl)-2-N-[3-(2-methylpiperidin-1-yl)propyl]pyrimidine-2,4-diamine (PubChem CID 154463494) has the molecular formula C18H33N5 and a molecular weight of 319.50 g/mol. Its IUPAC name is 4-N-(3-methylbutyl)-2-N-[3-(2-methylpiperidin-1-yl)propyl]pyrimidine-2,4-diamine.
| Compound Name | 4-N-(3-methylbutyl)-2-N-[3-(2-methylpiperidin-1-yl)propyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 154463494 |
| Molecular Formula | C18H33N5 |
| Molecular Weight | 319.50 g/mol |
| Exact Mass | 319.27 |
| IUPAC Name | 4-N-(3-methylbutyl)-2-N-[3-(2-methylpiperidin-1-yl)propyl]pyrimidine-2,4-diamine |
| SMILES | CC(C)CCNc1ccnc(NCCCN2CCCCC2C)n1 |
| InChI | InChI=1S/C18H33N5/c1-15(2)8-11-19-17-9-12-21-18(22-17)20-10-6-14-23-13-5-4-7-16(23)3/h9,12,15-16H,4-8,10-11,13-14H2,1-3H3,(H2,19,20,21,22) |
| InChIKey | ZTFHKBURZFOSBD-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.50 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|