C10H12N4OS — CID 103426993
3-amino-5-(3-methoxypropylamino)thiophene-2,4-dicarbonitrile (PubChem CID 103426993) has the molecular formula C10H12N4OS and a molecular weight of 236.30 g/mol. Its IUPAC name is 3-amino-5-(3-methoxypropylamino)thiophene-2,4-dicarbonitrile.
| Compound Name | 3-amino-5-(3-methoxypropylamino)thiophene-2,4-dicarbonitrile |
|---|---|
| PubChem CID | 103426993 |
| Molecular Formula | C10H12N4OS |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | 3-amino-5-(3-methoxypropylamino)thiophene-2,4-dicarbonitrile |
| SMILES | COCCCNc1sc(C#N)c(N)c1C#N |
| InChI | InChI=1S/C10H12N4OS/c1-15-4-2-3-14-10-7(5-11)9(13)8(6-12)16-10/h14H,2-4,13H2,1H3 |
| InChIKey | IMMAZZBSBUTEHI-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 94.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|