C9H12N4OS — CID 103423198
4-amino-5-cyano-2-(propan-2-ylamino)thiophene-3-carboxamide (PubChem CID 103423198) has the molecular formula C9H12N4OS and a molecular weight of 224.29 g/mol. Its IUPAC name is 4-amino-5-cyano-2-(propan-2-ylamino)thiophene-3-carboxamide.
| Compound Name | 4-amino-5-cyano-2-(propan-2-ylamino)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 103423198 |
| Molecular Formula | C9H12N4OS |
| Molecular Weight | 224.29 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | 4-amino-5-cyano-2-(propan-2-ylamino)thiophene-3-carboxamide |
| SMILES | CC(C)Nc1sc(C#N)c(N)c1C(N)=O |
| InChI | InChI=1S/C9H12N4OS/c1-4(2)13-9-6(8(12)14)7(11)5(3-10)15-9/h4,13H,11H2,1-2H3,(H2,12,14) |
| InChIKey | XUCITMIOBPKNEG-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 104.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.29 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |