C14H24N2O2S2 — CID 103417825
ethyl 3-amino-5-[methyl(3-methylbutyl)amino]-4-methylsulfanylthiophene-2-carboxylate (PubChem CID 103417825) has the molecular formula C14H24N2O2S2 and a molecular weight of 316.49 g/mol. Its IUPAC name is ethyl 3-amino-5-[methyl(3-methylbutyl)amino]-4-methylsulfanylthiophene-2-carboxylate.
| Compound Name | ethyl 3-amino-5-[methyl(3-methylbutyl)amino]-4-methylsulfanylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 103417825 |
| Molecular Formula | C14H24N2O2S2 |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | ethyl 3-amino-5-[methyl(3-methylbutyl)amino]-4-methylsulfanylthiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(N(C)CCC(C)C)c(SC)c1N |
| InChI | InChI=1S/C14H24N2O2S2/c1-6-18-14(17)12-10(15)11(19-5)13(20-12)16(4)8-7-9(2)3/h9H,6-8,15H2,1-5H3 |
| InChIKey | ILVFQLCOHYEEIX-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |