C11H17N5S2 — CID 103505866
3-amino-5-[(4-methylpiperazin-1-yl)amino]-4-methylsulfanylthiophene-2-carbonitrile (PubChem CID 103505866) has the molecular formula C11H17N5S2 and a molecular weight of 283.43 g/mol. Its IUPAC name is 3-amino-5-[(4-methylpiperazin-1-yl)amino]-4-methylsulfanylthiophene-2-carbonitrile.
| Compound Name | 3-amino-5-[(4-methylpiperazin-1-yl)amino]-4-methylsulfanylthiophene-2-carbonitrile |
|---|---|
| PubChem CID | 103505866 |
| Molecular Formula | C11H17N5S2 |
| Molecular Weight | 283.43 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 3-amino-5-[(4-methylpiperazin-1-yl)amino]-4-methylsulfanylthiophene-2-carbonitrile |
| SMILES | CSc1c(NN2CCN(C)CC2)sc(C#N)c1N |
| InChI | InChI=1S/C11H17N5S2/c1-15-3-5-16(6-4-15)14-11-10(17-2)9(13)8(7-12)18-11/h14H,3-6,13H2,1-2H3 |
| InChIKey | AXENTGVGAAUJPL-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 68.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.43 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |