C15H23N3 — CID 113337282
6-methyl-2-(octylamino)pyridine-3-carbonitrile (PubChem CID 113337282) has the molecular formula C15H23N3 and a molecular weight of 245.37 g/mol. Its IUPAC name is 6-methyl-2-(octylamino)pyridine-3-carbonitrile.
| Compound Name | 6-methyl-2-(octylamino)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 113337282 |
| Molecular Formula | C15H23N3 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.19 |
| IUPAC Name | 6-methyl-2-(octylamino)pyridine-3-carbonitrile |
| SMILES | CCCCCCCCNc1nc(C)ccc1C#N |
| InChI | InChI=1S/C15H23N3/c1-3-4-5-6-7-8-11-17-15-14(12-16)10-9-13(2)18-15/h9-10H,3-8,11H2,1-2H3,(H,17,18) |
| InChIKey | CAQDQZKNBXGWKQ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|