C10H12FN3 — CID 130504273
2-(3-fluoropropylamino)-6-methylpyridine-3-carbonitrile (PubChem CID 130504273) has the molecular formula C10H12FN3 and a molecular weight of 193.22 g/mol. Its IUPAC name is 2-(3-fluoropropylamino)-6-methylpyridine-3-carbonitrile.
| Compound Name | 2-(3-fluoropropylamino)-6-methylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 130504273 |
| Molecular Formula | C10H12FN3 |
| Molecular Weight | 193.22 g/mol |
| Exact Mass | 193.10 |
| IUPAC Name | 2-(3-fluoropropylamino)-6-methylpyridine-3-carbonitrile |
| SMILES | Cc1ccc(C#N)c(NCCCF)n1 |
| InChI | InChI=1S/C10H12FN3/c1-8-3-4-9(7-12)10(14-8)13-6-2-5-11/h3-4H,2,5-6H2,1H3,(H,13,14) |
| InChIKey | MXFRYGLSDUVBOT-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.22 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|