C18H17Br2NO4 — CID 92905136
(2R)-2-[(1S,2S,6R,7R,8R,9R)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-3-phenylpropanoic acid (PubChem CID 92905136) has the molecular formula C18H17Br2NO4 and a molecular weight of 471.15 g/mol. Its IUPAC name is (2R)-2-[(1S,2S,6R,7R,8R,9R)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-3-phenylpropanoic acid.
| Compound Name | (2R)-2-[(1S,2S,6R,7R,8R,9R)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 92905136 |
| Molecular Formula | C18H17Br2NO4 |
| Molecular Weight | 471.15 g/mol |
| Exact Mass | 468.95 |
| IUPAC Name | (2R)-2-[(1S,2S,6R,7R,8R,9R)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-3-phenylpropanoic acid |
| SMILES | O=C(O)[C@@H](Cc1ccccc1)N1C(=O)[C@@H]2[C@@H]3C[C@@H]([C@@H](Br)[C@@H]3Br)[C@@H]2C1=O |
| InChI | InChI=1S/C18H17Br2NO4/c19-14-9-7-10(15(14)20)13-12(9)16(22)21(17(13)23)11(18(24)25)6-8-4-2-1-3-5-8/h1-5,9-15H,6-7H2,(H,24,25)/t9-,10+,11-,12+,13-,14-,15-/m1/s1 |
| InChIKey | HVAMYIZDAHIWOZ-NKHBCJIASA-N |
| XLogP | 2.46 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.15 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|