C19H20Br2N2O3 — CID 124717571
(2R)-N-benzyl-2-[(1R,2S,6R,7R,8S,9S)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]propanamide (PubChem CID 124717571) has the molecular formula C19H20Br2N2O3 and a molecular weight of 484.19 g/mol. Its IUPAC name is (2R)-N-benzyl-2-[(1R,2S,6R,7R,8S,9S)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]propanamide.
| Compound Name | (2R)-N-benzyl-2-[(1R,2S,6R,7R,8S,9S)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]propanamide |
|---|---|
| PubChem CID | 124717571 |
| Molecular Formula | C19H20Br2N2O3 |
| Molecular Weight | 484.19 g/mol |
| Exact Mass | 481.98 |
| IUPAC Name | (2R)-N-benzyl-2-[(1R,2S,6R,7R,8S,9S)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]propanamide |
| SMILES | C[C@H](C(=O)NCc1ccccc1)N1C(=O)[C@@H]2[C@H]3C[C@@H]([C@H](Br)[C@H]3Br)[C@@H]2C1=O |
| InChI | InChI=1S/C19H20Br2N2O3/c1-9(17(24)22-8-10-5-3-2-4-6-10)23-18(25)13-11-7-12(14(13)19(23)26)16(21)15(11)20/h2-6,9,11-16H,7-8H2,1H3,(H,22,24)/t9-,11-,12-,13-,14+,15+,16+/m1/s1 |
| InChIKey | XWGMBEHPGIAUQF-WKCORYFBSA-N |
| XLogP | 2.47 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.19 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|