C18H17Br2FN2O3 — CID 124713104
(2R)-2-[(1R,2S,6S,7R,8S,9S)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-N-(4-fluorophenyl)propanamide (PubChem CID 124713104) has the molecular formula C18H17Br2FN2O3 and a molecular weight of 488.15 g/mol. Its IUPAC name is (2R)-2-[(1R,2S,6S,7R,8S,9S)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-N-(4-fluorophenyl)propanamide.
| Compound Name | (2R)-2-[(1R,2S,6S,7R,8S,9S)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-N-(4-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 124713104 |
| Molecular Formula | C18H17Br2FN2O3 |
| Molecular Weight | 488.15 g/mol |
| Exact Mass | 485.96 |
| IUPAC Name | (2R)-2-[(1R,2S,6S,7R,8S,9S)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-N-(4-fluorophenyl)propanamide |
| SMILES | C[C@H](C(=O)Nc1ccc(F)cc1)N1C(=O)[C@@H]2[C@H]3C[C@@H]([C@H](Br)[C@H]3Br)[C@H]2C1=O |
| InChI | InChI=1S/C18H17Br2FN2O3/c1-7(16(24)22-9-4-2-8(21)3-5-9)23-17(25)12-10-6-11(13(12)18(23)26)15(20)14(10)19/h2-5,7,10-15H,6H2,1H3,(H,22,24)/t7-,10-,11-,12-,13-,14+,15+/m1/s1 |
| InChIKey | DKNJZBIFGOBHFU-SEYSKFQBSA-N |
| XLogP | 2.93 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.15 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|