C20H21Br3N2O3 — CID 100807264
(2R)-N-(4-bromo-2,5-dimethylphenyl)-2-[(1S,2R,6R,7R,8R,9R)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]propanamide (PubChem CID 100807264) has the molecular formula C20H21Br3N2O3 and a molecular weight of 577.11 g/mol. Its IUPAC name is (2R)-N-(4-bromo-2,5-dimethylphenyl)-2-[(1S,2R,6R,7R,8R,9R)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]propanamide.
| Compound Name | (2R)-N-(4-bromo-2,5-dimethylphenyl)-2-[(1S,2R,6R,7R,8R,9R)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]propanamide |
|---|---|
| PubChem CID | 100807264 |
| Molecular Formula | C20H21Br3N2O3 |
| Molecular Weight | 577.11 g/mol |
| Exact Mass | 573.91 |
| IUPAC Name | (2R)-N-(4-bromo-2,5-dimethylphenyl)-2-[(1S,2R,6R,7R,8R,9R)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]propanamide |
| SMILES | Cc1cc(NC(=O)[C@@H](C)N2C(=O)[C@H]3[C@@H]4C[C@@H]([C@@H](Br)[C@@H]4Br)[C@@H]3C2=O)c(C)cc1Br |
| InChI | InChI=1S/C20H21Br3N2O3/c1-7-5-13(8(2)4-12(7)21)24-18(26)9(3)25-19(27)14-10-6-11(15(14)20(25)28)17(23)16(10)22/h4-5,9-11,14-17H,6H2,1-3H3,(H,24,26)/t9-,10-,11+,14+,15+,16-,17-/m1/s1 |
| InChIKey | IFWNZUBVPWZXCW-CPZMAPAHSA-N |
| XLogP | 4.17 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.11 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|