C21H24Br2N2O3 — CID 100803873
(2R)-2-[(1S,2R,6R,7R,8R,9R)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-3-methyl-N-(4-methylphenyl)butanamide (PubChem CID 100803873) has the molecular formula C21H24Br2N2O3 and a molecular weight of 512.24 g/mol. Its IUPAC name is (2R)-2-[(1S,2R,6R,7R,8R,9R)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-3-methyl-N-(4-methylphenyl)butanamide.
| Compound Name | (2R)-2-[(1S,2R,6R,7R,8R,9R)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-3-methyl-N-(4-methylphenyl)butanamide |
|---|---|
| PubChem CID | 100803873 |
| Molecular Formula | C21H24Br2N2O3 |
| Molecular Weight | 512.24 g/mol |
| Exact Mass | 510.02 |
| IUPAC Name | (2R)-2-[(1S,2R,6R,7R,8R,9R)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-3-methyl-N-(4-methylphenyl)butanamide |
| SMILES | Cc1ccc(NC(=O)[C@@H](C(C)C)N2C(=O)[C@H]3[C@@H]4C[C@@H]([C@@H](Br)[C@@H]4Br)[C@@H]3C2=O)cc1 |
| InChI | InChI=1S/C21H24Br2N2O3/c1-9(2)18(19(26)24-11-6-4-10(3)5-7-11)25-20(27)14-12-8-13(15(14)21(25)28)17(23)16(12)22/h4-7,9,12-18H,8H2,1-3H3,(H,24,26)/t12-,13+,14-,15-,16+,17+,18+/m0/s1 |
| InChIKey | QLLATJSJRGLHJW-SRBGOCBZSA-N |
| XLogP | 3.74 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.24 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|