C25H22Br3ClN2O3 — CID 99658591
(2R)-N-(4-bromo-3-chloro-2-methylphenyl)-2-[(1S,2R,6S,7S,8R,9S)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-3-phenylpropanamide (PubChem CID 99658591) has the molecular formula C25H22Br3ClN2O3 and a molecular weight of 673.63 g/mol. Its IUPAC name is (2R)-N-(4-bromo-3-chloro-2-methylphenyl)-2-[(1S,2R,6S,7S,8R,9S)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-3-phenylpropanamide.
| Compound Name | (2R)-N-(4-bromo-3-chloro-2-methylphenyl)-2-[(1S,2R,6S,7S,8R,9S)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 99658591 |
| Molecular Formula | C25H22Br3ClN2O3 |
| Molecular Weight | 673.63 g/mol |
| Exact Mass | 669.89 |
| IUPAC Name | (2R)-N-(4-bromo-3-chloro-2-methylphenyl)-2-[(1S,2R,6S,7S,8R,9S)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-3-phenylpropanamide |
| SMILES | Cc1c(NC(=O)[C@@H](Cc2ccccc2)N2C(=O)[C@@H]3[C@@H]4C[C@H]([C@H](Br)[C@@H]4Br)[C@@H]3C2=O)ccc(Br)c1Cl |
| InChI | InChI=1S/C25H22Br3ClN2O3/c1-11-16(8-7-15(26)22(11)29)30-23(32)17(9-12-5-3-2-4-6-12)31-24(33)18-13-10-14(19(18)25(31)34)21(28)20(13)27/h2-8,13-14,17-21H,9-10H2,1H3,(H,30,32)/t13-,14-,17+,18-,19+,20-,21+/m0/s1 |
| InChIKey | JBPMOWFLFUBGDW-HAERXCPCSA-N |
| XLogP | 5.74 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.63 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|