C18H23NO4 — CID 90883366
(5S)-3-acetyl-1-[(3-methoxyphenyl)methyl]-5-(2-methylpropyl)pyrrolidine-2,4-dione (PubChem CID 90883366) has the molecular formula C18H23NO4 and a molecular weight of 317.38 g/mol. Its IUPAC name is (5S)-3-acetyl-1-[(3-methoxyphenyl)methyl]-5-(2-methylpropyl)pyrrolidine-2,4-dione.
| Compound Name | (5S)-3-acetyl-1-[(3-methoxyphenyl)methyl]-5-(2-methylpropyl)pyrrolidine-2,4-dione |
|---|---|
| PubChem CID | 90883366 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | (5S)-3-acetyl-1-[(3-methoxyphenyl)methyl]-5-(2-methylpropyl)pyrrolidine-2,4-dione |
| SMILES | COc1cccc(CN2C(=O)C(C(C)=O)C(=O)[C@@H]2CC(C)C)c1 |
| InChI | InChI=1S/C18H23NO4/c1-11(2)8-15-17(21)16(12(3)20)18(22)19(15)10-13-6-5-7-14(9-13)23-4/h5-7,9,11,15-16H,8,10H2,1-4H3/t15-,16?/m0/s1 |
| InChIKey | YXCUIFSKBLVBSS-VYRBHSGPSA-N |
| XLogP | 2.23 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|