C19H26N4O4 — CID 97133125
(5R)-5-[2-[4-[(3-methoxyphenyl)methyl]piperazin-1-yl]-2-oxoethyl]-1,3-dimethylimidazolidine-2,4-dione (PubChem CID 97133125) has the molecular formula C19H26N4O4 and a molecular weight of 374.44 g/mol. Its IUPAC name is (5R)-5-[2-[4-[(3-methoxyphenyl)methyl]piperazin-1-yl]-2-oxoethyl]-1,3-dimethylimidazolidine-2,4-dione.
| Compound Name | (5R)-5-[2-[4-[(3-methoxyphenyl)methyl]piperazin-1-yl]-2-oxoethyl]-1,3-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 97133125 |
| Molecular Formula | C19H26N4O4 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | (5R)-5-[2-[4-[(3-methoxyphenyl)methyl]piperazin-1-yl]-2-oxoethyl]-1,3-dimethylimidazolidine-2,4-dione |
| SMILES | COc1cccc(CN2CCN(C(=O)C[C@@H]3C(=O)N(C)C(=O)N3C)CC2)c1 |
| InChI | InChI=1S/C19H26N4O4/c1-20-16(18(25)21(2)19(20)26)12-17(24)23-9-7-22(8-10-23)13-14-5-4-6-15(11-14)27-3/h4-6,11,16H,7-10,12-13H2,1-3H3/t16-/m1/s1 |
| InChIKey | LOMVQLPGKWURSW-MRXNPFEDSA-N |
| XLogP | 0.62 |
| TPSA | 73.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|