C28H30N2O10 — CID 11215029
methyl 2-[(2S,5S)-5-(2-methoxy-2-oxoethyl)-3,6-dioxo-1,4-bis(2-oxo-2-phenylmethoxyethyl)piperazin-2-yl]acetate (PubChem CID 11215029) has the molecular formula C28H30N2O10 and a molecular weight of 554.55 g/mol. Its IUPAC name is methyl 2-[(2S,5S)-5-(2-methoxy-2-oxoethyl)-3,6-dioxo-1,4-bis(2-oxo-2-phenylmethoxyethyl)piperazin-2-yl]acetate.
| Compound Name | methyl 2-[(2S,5S)-5-(2-methoxy-2-oxoethyl)-3,6-dioxo-1,4-bis(2-oxo-2-phenylmethoxyethyl)piperazin-2-yl]acetate |
|---|---|
| PubChem CID | 11215029 |
| Molecular Formula | C28H30N2O10 |
| Molecular Weight | 554.55 g/mol |
| Exact Mass | 554.19 |
| IUPAC Name | methyl 2-[(2S,5S)-5-(2-methoxy-2-oxoethyl)-3,6-dioxo-1,4-bis(2-oxo-2-phenylmethoxyethyl)piperazin-2-yl]acetate |
| SMILES | COC(=O)C[C@H]1C(=O)N(CC(=O)OCc2ccccc2)[C@@H](CC(=O)OC)C(=O)N1CC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C28H30N2O10/c1-37-23(31)13-21-27(35)30(16-26(34)40-18-20-11-7-4-8-12-20)22(14-24(32)38-2)28(36)29(21)15-25(33)39-17-19-9-5-3-6-10-19/h3-12,21-22H,13-18H2,1-2H3/t21-,22-/m0/s1 |
| InChIKey | OCFHYFRNPGRMQO-VXKWHMMOSA-N |
| XLogP | 1.01 |
| TPSA | 145.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.55 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|