C17H23N3O4 — CID 91343931
benzyl 2-[[2-(3,6-dimethyl-2-oxopiperazin-1-yl)acetyl]amino]acetate (PubChem CID 91343931) has the molecular formula C17H23N3O4 and a molecular weight of 333.39 g/mol. Its IUPAC name is benzyl 2-[[2-(3,6-dimethyl-2-oxopiperazin-1-yl)acetyl]amino]acetate.
| Compound Name | benzyl 2-[[2-(3,6-dimethyl-2-oxopiperazin-1-yl)acetyl]amino]acetate |
|---|---|
| PubChem CID | 91343931 |
| Molecular Formula | C17H23N3O4 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | benzyl 2-[[2-(3,6-dimethyl-2-oxopiperazin-1-yl)acetyl]amino]acetate |
| SMILES | CC1NCC(C)N(CC(=O)NCC(=O)OCc2ccccc2)C1=O |
| InChI | InChI=1S/C17H23N3O4/c1-12-8-18-13(2)17(23)20(12)10-15(21)19-9-16(22)24-11-14-6-4-3-5-7-14/h3-7,12-13,18H,8-11H2,1-2H3,(H,19,21) |
| InChIKey | QXCJDYUTSIIWEQ-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |