C20H20N4O3S — CID 27711358
benzyl 2-[[2-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetyl]amino]acetate (PubChem CID 27711358) has the molecular formula C20H20N4O3S and a molecular weight of 396.47 g/mol. Its IUPAC name is benzyl 2-[[2-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetyl]amino]acetate.
| Compound Name | benzyl 2-[[2-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetyl]amino]acetate |
|---|---|
| PubChem CID | 27711358 |
| Molecular Formula | C20H20N4O3S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | benzyl 2-[[2-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetyl]amino]acetate |
| SMILES | Cc1ccc(-c2n[nH]c(=S)n2CC(=O)NCC(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C20H20N4O3S/c1-14-7-9-16(10-8-14)19-22-23-20(28)24(19)12-17(25)21-11-18(26)27-13-15-5-3-2-4-6-15/h2-10H,11-13H2,1H3,(H,21,25)(H,23,28) |
| InChIKey | XUKSCTJLJROZCM-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 89.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|