C21H18N6OS — CID 134056285
2-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-(2-phenylpyrimidin-5-yl)acetamide (PubChem CID 134056285) has the molecular formula C21H18N6OS and a molecular weight of 402.48 g/mol. Its IUPAC name is 2-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-(2-phenylpyrimidin-5-yl)acetamide.
| Compound Name | 2-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-(2-phenylpyrimidin-5-yl)acetamide |
|---|---|
| PubChem CID | 134056285 |
| Molecular Formula | C21H18N6OS |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | 2-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-(2-phenylpyrimidin-5-yl)acetamide |
| SMILES | Cc1ccc(-c2n[nH]c(=S)n2CC(=O)Nc2cnc(-c3ccccc3)nc2)cc1 |
| InChI | InChI=1S/C21H18N6OS/c1-14-7-9-16(10-8-14)20-25-26-21(29)27(20)13-18(28)24-17-11-22-19(23-12-17)15-5-3-2-4-6-15/h2-12H,13H2,1H3,(H,24,28)(H,26,29) |
| InChIKey | FQLCXEROKOGNOQ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|