C24H28N6O2S — CID 16613458
2-[4-[[2-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetyl]amino]piperidin-1-yl]-N-phenylacetamide (PubChem CID 16613458) has the molecular formula C24H28N6O2S and a molecular weight of 464.60 g/mol. Its IUPAC name is 2-[4-[[2-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetyl]amino]piperidin-1-yl]-N-phenylacetamide.
| Compound Name | 2-[4-[[2-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetyl]amino]piperidin-1-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 16613458 |
| Molecular Formula | C24H28N6O2S |
| Molecular Weight | 464.60 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | 2-[4-[[2-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetyl]amino]piperidin-1-yl]-N-phenylacetamide |
| SMILES | Cc1ccc(-c2n[nH]c(=S)n2CC(=O)NC2CCN(CC(=O)Nc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C24H28N6O2S/c1-17-7-9-18(10-8-17)23-27-28-24(33)30(23)16-22(32)26-20-11-13-29(14-12-20)15-21(31)25-19-5-3-2-4-6-19/h2-10,20H,11-16H2,1H3,(H,25,31)(H,26,32)(H,28,33) |
| InChIKey | WTTBQFNVGJCVRV-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 95.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.60 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|