C23H27N5O2S — CID 86966316
N-[1-(2-methoxyphenyl)piperidin-3-yl]-2-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetamide (PubChem CID 86966316) has the molecular formula C23H27N5O2S and a molecular weight of 437.57 g/mol. Its IUPAC name is N-[1-(2-methoxyphenyl)piperidin-3-yl]-2-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetamide.
| Compound Name | N-[1-(2-methoxyphenyl)piperidin-3-yl]-2-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetamide |
|---|---|
| PubChem CID | 86966316 |
| Molecular Formula | C23H27N5O2S |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | N-[1-(2-methoxyphenyl)piperidin-3-yl]-2-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetamide |
| SMILES | COc1ccccc1N1CCCC(NC(=O)Cn2c(-c3ccc(C)cc3)n[nH]c2=S)C1 |
| InChI | InChI=1S/C23H27N5O2S/c1-16-9-11-17(12-10-16)22-25-26-23(31)28(22)15-21(29)24-18-6-5-13-27(14-18)19-7-3-4-8-20(19)30-2/h3-4,7-12,18H,5-6,13-15H2,1-2H3,(H,24,29)(H,26,31) |
| InChIKey | VUGJAWPBLHKIBQ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 75.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|