C20H20N4OS2 — CID 24547801
N-(3,4-dihydro-2H-thiochromen-4-yl)-2-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetamide (PubChem CID 24547801) has the molecular formula C20H20N4OS2 and a molecular weight of 396.54 g/mol. Its IUPAC name is N-(3,4-dihydro-2H-thiochromen-4-yl)-2-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetamide.
| Compound Name | N-(3,4-dihydro-2H-thiochromen-4-yl)-2-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetamide |
|---|---|
| PubChem CID | 24547801 |
| Molecular Formula | C20H20N4OS2 |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | N-(3,4-dihydro-2H-thiochromen-4-yl)-2-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetamide |
| SMILES | Cc1ccc(-c2n[nH]c(=S)n2CC(=O)NC2CCSc3ccccc32)cc1 |
| InChI | InChI=1S/C20H20N4OS2/c1-13-6-8-14(9-7-13)19-22-23-20(26)24(19)12-18(25)21-16-10-11-27-17-5-3-2-4-15(16)17/h2-9,16H,10-12H2,1H3,(H,21,25)(H,23,26) |
| InChIKey | WBWQDFUWCVAFOD-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|