C19H20N4O2S — CID 86924851
2-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-(4,5,6,7-tetrahydro-1-benzofuran-4-yl)acetamide (PubChem CID 86924851) has the molecular formula C19H20N4O2S and a molecular weight of 368.46 g/mol. Its IUPAC name is 2-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-(4,5,6,7-tetrahydro-1-benzofuran-4-yl)acetamide.
| Compound Name | 2-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-(4,5,6,7-tetrahydro-1-benzofuran-4-yl)acetamide |
|---|---|
| PubChem CID | 86924851 |
| Molecular Formula | C19H20N4O2S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 2-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-(4,5,6,7-tetrahydro-1-benzofuran-4-yl)acetamide |
| SMILES | Cc1cccc(-c2n[nH]c(=S)n2CC(=O)NC2CCCc3occc32)c1 |
| InChI | InChI=1S/C19H20N4O2S/c1-12-4-2-5-13(10-12)18-21-22-19(26)23(18)11-17(24)20-15-6-3-7-16-14(15)8-9-25-16/h2,4-5,8-10,15H,3,6-7,11H2,1H3,(H,20,24)(H,22,26) |
| InChIKey | KXBPLVIHUGMJIP-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 75.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|