C13H16N4O2S — CID 18169072
N-ethoxy-2-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetamide (PubChem CID 18169072) has the molecular formula C13H16N4O2S and a molecular weight of 292.36 g/mol. Its IUPAC name is N-ethoxy-2-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetamide.
| Compound Name | N-ethoxy-2-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetamide |
|---|---|
| PubChem CID | 18169072 |
| Molecular Formula | C13H16N4O2S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | N-ethoxy-2-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetamide |
| SMILES | CCONC(=O)Cn1c(-c2cccc(C)c2)n[nH]c1=S |
| InChI | InChI=1S/C13H16N4O2S/c1-3-19-16-11(18)8-17-12(14-15-13(17)20)10-6-4-5-9(2)7-10/h4-7H,3,8H2,1-2H3,(H,15,20)(H,16,18) |
| InChIKey | WBPWFJGCFQCQPB-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 71.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|