C22H25N5O2S — CID 39694077
N,N-diethyl-4-[[2-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetyl]amino]benzamide (PubChem CID 39694077) has the molecular formula C22H25N5O2S and a molecular weight of 423.54 g/mol. Its IUPAC name is N,N-diethyl-4-[[2-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetyl]amino]benzamide.
| Compound Name | N,N-diethyl-4-[[2-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 39694077 |
| Molecular Formula | C22H25N5O2S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | N,N-diethyl-4-[[2-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetyl]amino]benzamide |
| SMILES | CCN(CC)C(=O)c1ccc(NC(=O)Cn2c(-c3cccc(C)c3)n[nH]c2=S)cc1 |
| InChI | InChI=1S/C22H25N5O2S/c1-4-26(5-2)21(29)16-9-11-18(12-10-16)23-19(28)14-27-20(24-25-22(27)30)17-8-6-7-15(3)13-17/h6-13H,4-5,14H2,1-3H3,(H,23,28)(H,25,30) |
| InChIKey | ONGRXYHBGKDYTD-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 83.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|