C22H25N5O2S — CID 60515772
N-[4-[[[2-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetyl]amino]methyl]phenyl]butanamide (PubChem CID 60515772) has the molecular formula C22H25N5O2S and a molecular weight of 423.54 g/mol. Its IUPAC name is N-[4-[[[2-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetyl]amino]methyl]phenyl]butanamide.
| Compound Name | N-[4-[[[2-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetyl]amino]methyl]phenyl]butanamide |
|---|---|
| PubChem CID | 60515772 |
| Molecular Formula | C22H25N5O2S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | N-[4-[[[2-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetyl]amino]methyl]phenyl]butanamide |
| SMILES | CCCC(=O)Nc1ccc(CNC(=O)Cn2c(-c3cccc(C)c3)n[nH]c2=S)cc1 |
| InChI | InChI=1S/C22H25N5O2S/c1-3-5-19(28)24-18-10-8-16(9-11-18)13-23-20(29)14-27-21(25-26-22(27)30)17-7-4-6-15(2)12-17/h4,6-12H,3,5,13-14H2,1-2H3,(H,23,29)(H,24,28)(H,26,30) |
| InChIKey | BPEMQJODNWIIRM-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 91.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|