C24H21FN4O2S — CID 17488484
N-[[4-(4-fluorophenoxy)phenyl]methyl]-2-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetamide (PubChem CID 17488484) has the molecular formula C24H21FN4O2S and a molecular weight of 448.52 g/mol. Its IUPAC name is N-[[4-(4-fluorophenoxy)phenyl]methyl]-2-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetamide.
| Compound Name | N-[[4-(4-fluorophenoxy)phenyl]methyl]-2-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetamide |
|---|---|
| PubChem CID | 17488484 |
| Molecular Formula | C24H21FN4O2S |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | N-[[4-(4-fluorophenoxy)phenyl]methyl]-2-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetamide |
| SMILES | Cc1cccc(-c2n[nH]c(=S)n2CC(=O)NCc2ccc(Oc3ccc(F)cc3)cc2)c1 |
| InChI | InChI=1S/C24H21FN4O2S/c1-16-3-2-4-18(13-16)23-27-28-24(32)29(23)15-22(30)26-14-17-5-9-20(10-6-17)31-21-11-7-19(25)8-12-21/h2-13H,14-15H2,1H3,(H,26,30)(H,28,32) |
| InChIKey | KMBZMONIWUFXNK-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 71.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|