C21H22N6OS — CID 18116733
N-[(1-ethylbenzimidazol-2-yl)methyl]-2-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetamide (PubChem CID 18116733) has the molecular formula C21H22N6OS and a molecular weight of 406.52 g/mol. Its IUPAC name is N-[(1-ethylbenzimidazol-2-yl)methyl]-2-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetamide.
| Compound Name | N-[(1-ethylbenzimidazol-2-yl)methyl]-2-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetamide |
|---|---|
| PubChem CID | 18116733 |
| Molecular Formula | C21H22N6OS |
| Molecular Weight | 406.52 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | N-[(1-ethylbenzimidazol-2-yl)methyl]-2-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetamide |
| SMILES | CCn1c(CNC(=O)Cn2c(-c3cccc(C)c3)n[nH]c2=S)nc2ccccc21 |
| InChI | InChI=1S/C21H22N6OS/c1-3-26-17-10-5-4-9-16(17)23-18(26)12-22-19(28)13-27-20(24-25-21(27)29)15-8-6-7-14(2)11-15/h4-11H,3,12-13H2,1-2H3,(H,22,28)(H,25,29) |
| InChIKey | VOMAVEVOKSUOIR-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 80.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.52 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|