C23H25N5O2S — CID 78843642
3-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-[4-(pyrrolidine-1-carbonyl)phenyl]propanamide (PubChem CID 78843642) has the molecular formula C23H25N5O2S and a molecular weight of 435.55 g/mol. Its IUPAC name is 3-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-[4-(pyrrolidine-1-carbonyl)phenyl]propanamide.
| Compound Name | 3-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-[4-(pyrrolidine-1-carbonyl)phenyl]propanamide |
|---|---|
| PubChem CID | 78843642 |
| Molecular Formula | C23H25N5O2S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | 3-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-[4-(pyrrolidine-1-carbonyl)phenyl]propanamide |
| SMILES | Cc1cccc(-c2n[nH]c(=S)n2CCC(=O)Nc2ccc(C(=O)N3CCCC3)cc2)c1 |
| InChI | InChI=1S/C23H25N5O2S/c1-16-5-4-6-18(15-16)21-25-26-23(31)28(21)14-11-20(29)24-19-9-7-17(8-10-19)22(30)27-12-2-3-13-27/h4-10,15H,2-3,11-14H2,1H3,(H,24,29)(H,26,31) |
| InChIKey | PHHQCDBRLXBCFI-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 83.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|