C20H26N4O3S — CID 55767529
ethyl 1-[[2-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetyl]amino]cyclohexane-1-carboxylate (PubChem CID 55767529) has the molecular formula C20H26N4O3S and a molecular weight of 402.52 g/mol. Its IUPAC name is ethyl 1-[[2-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetyl]amino]cyclohexane-1-carboxylate.
| Compound Name | ethyl 1-[[2-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetyl]amino]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 55767529 |
| Molecular Formula | C20H26N4O3S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | ethyl 1-[[2-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetyl]amino]cyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1(NC(=O)Cn2c(-c3cccc(C)c3)n[nH]c2=S)CCCCC1 |
| InChI | InChI=1S/C20H26N4O3S/c1-3-27-18(26)20(10-5-4-6-11-20)21-16(25)13-24-17(22-23-19(24)28)15-9-7-8-14(2)12-15/h7-9,12H,3-6,10-11,13H2,1-2H3,(H,21,25)(H,23,28) |
| InChIKey | BQSKPGTUQIVXDN-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 89.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|