C21H23N5O2S — CID 27760636
N-(2,6-dimethylphenyl)-2-[[2-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetyl]amino]acetamide (PubChem CID 27760636) has the molecular formula C21H23N5O2S and a molecular weight of 409.52 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2-[[2-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetyl]amino]acetamide.
| Compound Name | N-(2,6-dimethylphenyl)-2-[[2-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetyl]amino]acetamide |
|---|---|
| PubChem CID | 27760636 |
| Molecular Formula | C21H23N5O2S |
| Molecular Weight | 409.52 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-[[2-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetyl]amino]acetamide |
| SMILES | Cc1ccc(-c2n[nH]c(=S)n2CC(=O)NCC(=O)Nc2c(C)cccc2C)cc1 |
| InChI | InChI=1S/C21H23N5O2S/c1-13-7-9-16(10-8-13)20-24-25-21(29)26(20)12-18(28)22-11-17(27)23-19-14(2)5-4-6-15(19)3/h4-10H,11-12H2,1-3H3,(H,22,28)(H,23,27)(H,25,29) |
| InChIKey | FJFVCZBLWRYKFI-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 91.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.52 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|