C19H19N5O2S — CID 32637031
3-[[[2-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetyl]amino]methyl]benzamide (PubChem CID 32637031) has the molecular formula C19H19N5O2S and a molecular weight of 381.46 g/mol. Its IUPAC name is 3-[[[2-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetyl]amino]methyl]benzamide.
| Compound Name | 3-[[[2-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 32637031 |
| Molecular Formula | C19H19N5O2S |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | 3-[[[2-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetyl]amino]methyl]benzamide |
| SMILES | Cc1ccc(-c2n[nH]c(=S)n2CC(=O)NCc2cccc(C(N)=O)c2)cc1 |
| InChI | InChI=1S/C19H19N5O2S/c1-12-5-7-14(8-6-12)18-22-23-19(27)24(18)11-16(25)21-10-13-3-2-4-15(9-13)17(20)26/h2-9H,10-11H2,1H3,(H2,20,26)(H,21,25)(H,23,27) |
| InChIKey | VTRIKJBOSHTTBO-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 105.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|