C12H8N2O3 — CID 3028843
1-phenyl-3-prop-2-ynylimidazolidine-2,4,5-trione (PubChem CID 3028843) has the molecular formula C12H8N2O3 and a molecular weight of 228.21 g/mol. Its IUPAC name is 1-phenyl-3-prop-2-ynylimidazolidine-2,4,5-trione.
| Compound Name | 1-phenyl-3-prop-2-ynylimidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 3028843 |
| Molecular Formula | C12H8N2O3 |
| Molecular Weight | 228.21 g/mol |
| Exact Mass | 228.05 |
| IUPAC Name | 1-phenyl-3-prop-2-ynylimidazolidine-2,4,5-trione |
| SMILES | C#CCN1C(=O)C(=O)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C12H8N2O3/c1-2-8-13-10(15)11(16)14(12(13)17)9-6-4-3-5-7-9/h1,3-7H,8H2 |
| InChIKey | QTQWGOYMQHIRKG-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.21 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|