C16H10N2O4 — CID 22323521
1,3-diphenyl-1,3-diazinane-2,4,5,6-tetrone (PubChem CID 22323521) has the molecular formula C16H10N2O4 and a molecular weight of 294.27 g/mol. Its IUPAC name is 1,3-diphenyl-1,3-diazinane-2,4,5,6-tetrone.
| Compound Name | 1,3-diphenyl-1,3-diazinane-2,4,5,6-tetrone |
|---|---|
| PubChem CID | 22323521 |
| Molecular Formula | C16H10N2O4 |
| Molecular Weight | 294.27 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | 1,3-diphenyl-1,3-diazinane-2,4,5,6-tetrone |
| SMILES | O=C1C(=O)N(c2ccccc2)C(=O)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C16H10N2O4/c19-13-14(20)17(11-7-3-1-4-8-11)16(22)18(15(13)21)12-9-5-2-6-10-12/h1-10H |
| InChIKey | BSKJDEYIFRVKPI-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.27 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|