C18H14N2O4 — CID 155228922
1,5-diphenyl-1,5-diazocane-2,4,6,8-tetrone (PubChem CID 155228922) has the molecular formula C18H14N2O4 and a molecular weight of 322.32 g/mol. Its IUPAC name is 1,5-diphenyl-1,5-diazocane-2,4,6,8-tetrone.
| Compound Name | 1,5-diphenyl-1,5-diazocane-2,4,6,8-tetrone |
|---|---|
| PubChem CID | 155228922 |
| Molecular Formula | C18H14N2O4 |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 1,5-diphenyl-1,5-diazocane-2,4,6,8-tetrone |
| SMILES | O=C1CC(=O)N(c2ccccc2)C(=O)CC(=O)N1c1ccccc1 |
| InChI | InChI=1S/C18H14N2O4/c21-15-11-17(23)20(14-9-5-2-6-10-14)18(24)12-16(22)19(15)13-7-3-1-4-8-13/h1-10H,11-12H2 |
| InChIKey | XKDBLLWRSDWJQX-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|